We unleash your business potential by maximize the business innovation.
Send Email| Name | 2-ethylhexyl 2-cyano-3,3-diphenyl-acrylate |
| Synonyms | N-539 PARSOL 340 EUSOLEX OCR Octocrylene octocrilene OCTOCRYLENE Uvinul 3039 Primesorb 3039 OCTYL 2-CYANO-3,3-DIPHENYLACRYLATE 2-Ethyl-2-cyano-3,3-Diphenylacrylate 2-ethylhexyl 2-cyano-3,3-diphenyl-acrylate 2-Ethylhexyl 2-cyano-3,3-diphenylpropenoate 2-ethylhexylalpha-cyano-beta-phenylcinnamate 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate 2-Cyano-3,3-diphenylacrylic acid 2-ethylhexyl ester 2-cyano-3,3-diphenyl-2-propenoicaci2-ethylhexylester 2-Cyano-3,3'-diphenyl acrylie acid-2-ethylhexyl ester 2-Propenoicacid,2-cyano-3,3-diphenyl-,2-ethylhexylester 2-Cyano-3,3-diphenyl-2-propanoic acid 2-ethylhexyl ester |
| CAS | 6197-30-4 |
| EINECS | 228-250-8 |
| InChI | InChI=1/C24H27NO2/c1-3-5-12-19(4-2)18-27-24(26)22(17-25)23(20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,19H,3-5,12,18H2,1-2H3 |
| InChIKey | FMJSMJQBSVNSBF-UHFFFAOYSA-N |
| Molecular Formula | C24H27NO2 |
| Molar Mass | 361.48 |
| Density | 1.051 g/mL at 25 °C (lit.) |
| Melting Point | -10 °C (lit.) |
| Boling Point | 218 °C/1.5 mmHg (lit.) |
| Flash Point | >230°F |
| Solubility | Chloroform (Slightly), Methanol (Sparingly) |
| Vapor Presure | 0Pa at 25℃ |
| Appearance | neat |
| Color | Colourless to Light Yellow |
| Merck | 14,6756 |
| Storage Condition | 15-25°C |
| Refractive Index | n20/D 1.567(lit.) |
| MDL | MFCD00059260 |
| Use | Used in plastics, coatings, dyes, etc. as UV absorbers |
| Risk Codes | 52 - Harmful to aquatic organisms |
| WGK Germany | 1 |
| RTECS | UD3328750 |
| HS Code | 29269095 |
| Toxicity | LD50 orl-rat: >5 g/kg NTIS** OTS0556792 |
| LogP | 6.1 at 23℃ |
| Absorption | uv max: 303 nm |
| Use | okliline is a UV-A and UV-B filter for sunscreen and topical pharmaceutical formulations. for plastics, coatings, dyes, etc. as UV absorber |
| biological activity | octopirene is an organic compound used in sunscreens and cosmetics. |