We unleash your business potential by maximize the business innovation.
Send EmailCitrulline malate, Stimol, L-Citrulline-Dl-Malate, 54940-97-5
Citrulline malate
CAS: 54940-97-5;70796-17-7
Molecular Formula: C10H19N3O8
Names and Identifiers
| Name | Citrulline malate |
| Synonyms | Stimol Citrulline malate L-Citrullin-DL-malate L-Citrulline-Dl-Malate N5-(Aminocarbonyl)-L-Ornithine 2-hydroxybutanedioate (S)-2-amino-5-ureidopentanoic acid 2-hydroxysuccinic acid salt |
| CAS | 54940-97-5 70796-17-7 |
| InChI | InChI=1/C6H13N3O3.C4H6O5/c7-4(5(10)11)2-1-3-9-6(8)12;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);2,5H,1H2,(H,6,7)(H,8,9)/t4-;/m0./s1 |
Physico-chemical Properties
| Molecular Formula | C10H19N3O8 |
| Molar Mass | 309.28 |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
Introduction
L-citrulline-DL-malic acid, also known as citrate citrate, is a compound composed of L-citrulline and DL malic acid.
Nature:
1. Appearance: White crystalline powder;
2. Solubility: soluble in water.
Usage:
1. Promote amino acid metabolism: L-citrulline is believed to have the effect of promoting protein synthesis and amino acid metabolism;
2. Improving exercise performance: It is also believed to enhance lactate endurance and exercise performance, reduce fatigue, and promote muscle recovery.
Method:
The preparation of L-citrulline-DL-malic acid is generally achieved by chemical synthesis of L-citrulline and DL malic acid. The specific preparation method can be achieved through chemical reactions for synthesis.
Security information:
1. Toxicity: L-citrulline-DL-malic acid is considered a relatively safe compound and generally has no toxicity;
2. Side effects: Although it is generally considered safe, high doses and long-term use may cause certain side effects, such as gastrointestinal discomfort and headache
3. Attention: For pregnant women, lactating women, and individuals with specific health issues such as liver disease, kidney disease, or cardiovascular problems, L-citrulline-DL-malic acid should be avoided.
