We unleash your business potential by maximize the business innovation.
Send EmailChlorhexidine Gluconate, Chlorhexdine digluconate, CHLOROHEXIDINE DIGLUCONATE, SOLUTION, 18472-51-0
| Name | Chlorhexidine Gluconate |
| Synonyms | ChlorhedineGluconate Chlorhexidine Gluconate Chlorhexdine digluconate Chlorhexidin bigluconate CHLOROHEXIDINE GLUCONATE Chlorhexidine digluconate CHLOROHEXIDINE DIGLUCONATE CHLOROHEXIDINE DIGLUCONATE, SOLUTION |
| CAS | 18472-51-0 |
| EINECS | 242-354-0 |
| InChI | InChI=1/C22H30Cl2N10.2C6H12O7/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*7-1-2(8)3(9)4(10)5(11)6(12)13/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*2-5,7-11H,1H2,(H,12,13) |
| InChIKey | YZIYKJHYYHPJIB-UUPCJSQJSA-N |
| Molecular Formula | C28H42Cl2N10O7 |
| Molar Mass | 701.61 |
| Density | 1.06g/mLat 25°C(lit.) |
| Melting Point | 134℃ |
| Boling Point | 1121.4°C at 760 mmHg |
| Flash Point | 632°C |
| Water Solubility | 750g/L at 20℃ |
| Solubility | water: soluble50% (w/v) |
| Vapor Presure | 0.005Pa at 25℃ |
| Appearance | Transparent liquid |
| Color | Colorless |
| Maximum wavelength(λmax) | ['257nm(H2O)(lit.)'] |
| Merck | 14,2091 |
| Storage Condition | 2-8°C |
| Sensitive | Light Sensitive |
| MDL | MFCD00083599 |
| Hazard Symbols | N - Dangerous for the environment![]() |
| Risk Codes | 50/53 - Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Safety Description | 61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 3082 9 / PGIII |
| WGK Germany | - |
| RTECS | DU1950000 |
| TSCA | Yes |
| HS Code | 29252900 |
| Hazard Class | 9 |
| Packing Group | III |
| Toxicity | LD50 in mice (mg/kg): 22 i.v.; 1800 orally (Foulkes) |